C19H35NO — CID 102217744
(3S,6R,12aR)-6-hexyl-1,2,3,4,6,7,8,8a,9,10,11,12-dodecahydrobenzo[j]quinolizin-3-ol (PubChem CID 102217744) has the molecular formula C19H35NO and a molecular weight of 293.50 g/mol. Its IUPAC name is (3S,6R,12aR)-6-hexyl-1,2,3,4,6,7,8,8a,9,10,11,12-dodecahydrobenzo[j]quinolizin-3-ol.
| Compound Name | (3S,6R,12aR)-6-hexyl-1,2,3,4,6,7,8,8a,9,10,11,12-dodecahydrobenzo[j]quinolizin-3-ol |
|---|---|
| PubChem CID | 102217744 |
| Molecular Formula | C19H35NO |
| Molecular Weight | 293.50 g/mol |
| Exact Mass | 293.27 |
| IUPAC Name | (3S,6R,12aR)-6-hexyl-1,2,3,4,6,7,8,8a,9,10,11,12-dodecahydrobenzo[j]quinolizin-3-ol |
| SMILES | CCCCCC[C@@H]1CCC2CCCC[C@@]23CC[C@H](O)CN13 |
| InChI | InChI=1S/C19H35NO/c1-2-3-4-5-9-17-11-10-16-8-6-7-13-19(16)14-12-18(21)15-20(17)19/h16-18,21H,2-15H2,1H3/t16?,17-,18+,19-/m1/s1 |
| InChIKey | LKWYTXHRLUJGSF-XVLXNVKGSA-N |
| XLogP | 4.50 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.50 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|