C42H56N2O8 — CID 10963615
tert-butyl (4S)-4-[3-[(2R,3S,4R,5R,6R)-3-acetamido-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]propyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 10963615) has the molecular formula C42H56N2O8 and a molecular weight of 716.92 g/mol. Its IUPAC name is tert-butyl (4S)-4-[3-[(2R,3S,4R,5R,6R)-3-acetamido-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]propyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4S)-4-[3-[(2R,3S,4R,5R,6R)-3-acetamido-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]propyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 10963615 |
| Molecular Formula | C42H56N2O8 |
| Molecular Weight | 716.92 g/mol |
| Exact Mass | 716.40 |
| IUPAC Name | tert-butyl (4S)-4-[3-[(2R,3S,4R,5R,6R)-3-acetamido-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]propyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | CC(=O)N[C@@H]1[C@@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H](COCc2ccccc2)O[C@@H]1CCC[C@H]1COC(C)(C)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C42H56N2O8/c1-30(45)43-37-35(24-16-23-34-28-50-42(5,6)44(34)40(46)52-41(2,3)4)51-36(29-47-25-31-17-10-7-11-18-31)38(48-26-32-19-12-8-13-20-32)39(37)49-27-33-21-14-9-15-22-33/h7-15,17-22,34-39H,16,23-29H2,1-6H3,(H,43,45)/t34-,35+,36+,37-,38-,39+/m0/s1 |
| InChIKey | PCPAWSPORXUDOI-HKOUNVRTSA-N |
| XLogP | 7.19 |
| TPSA | 104.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.92 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |