C48H56N2O9 — CID 23250413
tert-butyl (4S)-2,2-dimethyl-4-[[3-[(2S,3S,4R,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]-1,2-oxazol-5-yl]methyl]-1,3-oxazolidine-3-carboxylate (PubChem CID 23250413) has the molecular formula C48H56N2O9 and a molecular weight of 804.98 g/mol. Its IUPAC name is tert-butyl (4S)-2,2-dimethyl-4-[[3-[(2S,3S,4R,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]-1,2-oxazol-5-yl]methyl]-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4S)-2,2-dimethyl-4-[[3-[(2S,3S,4R,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]-1,2-oxazol-5-yl]methyl]-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 23250413 |
| Molecular Formula | C48H56N2O9 |
| Molecular Weight | 804.98 g/mol |
| Exact Mass | 804.40 |
| IUPAC Name | tert-butyl (4S)-2,2-dimethyl-4-[[3-[(2S,3S,4R,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]-1,2-oxazol-5-yl]methyl]-1,3-oxazolidine-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1[C@@H](Cc2cc([C@@H]3O[C@H](COCc4ccccc4)[C@H](OCc4ccccc4)[C@H](OCc4ccccc4)[C@H]3OCc3ccccc3)no2)COC1(C)C |
| InChI | InChI=1S/C48H56N2O9/c1-47(2,3)58-46(51)50-38(32-56-48(50,4)5)26-39-27-40(49-59-39)42-44(54-30-36-22-14-8-15-23-36)45(55-31-37-24-16-9-17-25-37)43(53-29-35-20-12-7-13-21-35)41(57-42)33-52-28-34-18-10-6-11-19-34/h6-25,27,38,41-45H,26,28-33H2,1-5H3/t38-,41+,42-,43-,44-,45-/m0/s1 |
| InChIKey | DVXABKDBBBFSLF-GAOKXYCISA-N |
| XLogP | 9.00 |
| TPSA | 110.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 804.98 |
| LogP ≤ 5 | 9.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |