C27H47NO7Si — CID 45277045
tert-butyl (4S)-4-[(1R,2S,3R)-4-[tert-butyl(dimethyl)silyl]oxy-2,3-dihydroxy-1-phenylmethoxybutyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 45277045) has the molecular formula C27H47NO7Si and a molecular weight of 525.76 g/mol. Its IUPAC name is tert-butyl (4S)-4-[(1R,2S,3R)-4-[tert-butyl(dimethyl)silyl]oxy-2,3-dihydroxy-1-phenylmethoxybutyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4S)-4-[(1R,2S,3R)-4-[tert-butyl(dimethyl)silyl]oxy-2,3-dihydroxy-1-phenylmethoxybutyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 45277045 |
| Molecular Formula | C27H47NO7Si |
| Molecular Weight | 525.76 g/mol |
| Exact Mass | 525.31 |
| IUPAC Name | tert-butyl (4S)-4-[(1R,2S,3R)-4-[tert-butyl(dimethyl)silyl]oxy-2,3-dihydroxy-1-phenylmethoxybutyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1[C@H]([C@@H](OCc2ccccc2)[C@@H](O)[C@H](O)CO[Si](C)(C)C(C)(C)C)COC1(C)C |
| InChI | InChI=1S/C27H47NO7Si/c1-25(2,3)35-24(31)28-20(17-33-27(28,7)8)23(32-16-19-14-12-11-13-15-19)22(30)21(29)18-34-36(9,10)26(4,5)6/h11-15,20-23,29-30H,16-18H2,1-10H3/t20-,21+,22-,23+/m0/s1 |
| InChIKey | OJDXMWMOFLVAKH-GSPCLOLRSA-N |
| XLogP | 4.69 |
| TPSA | 97.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.76 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|