C17H25NO4 — CID 169442028
tert-butyl (4S)-4-[(S)-(1,2,3,4,5,6-13C6)cyclohexatrienyl(hydroxy)methyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 169442028) has the molecular formula C17H25NO4 and a molecular weight of 313.34 g/mol. Its IUPAC name is tert-butyl (4S)-4-[(S)-(1,2,3,4,5,6-13C6)cyclohexatrienyl(hydroxy)methyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4S)-4-[(S)-(1,2,3,4,5,6-13C6)cyclohexatrienyl(hydroxy)methyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 169442028 |
| Molecular Formula | C17H25NO4 |
| Molecular Weight | 313.34 g/mol |
| Exact Mass | 313.20 |
| IUPAC Name | tert-butyl (4S)-4-[(S)-(1,2,3,4,5,6-13C6)cyclohexatrienyl(hydroxy)methyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1[C@H]([C@@H](O)[13c]2[13cH][13cH][13cH][13cH][13cH]2)COC1(C)C |
| InChI | InChI=1S/C17H25NO4/c1-16(2,3)22-15(20)18-13(11-21-17(18,4)5)14(19)12-9-7-6-8-10-12/h6-10,13-14,19H,11H2,1-5H3/t13-,14-/m0/s1/i6+1,7+1,8+1,9+1,10+1,12+1 |
| InChIKey | WLNSEHZFRWNFFR-QRJNAXCVSA-N |
| XLogP | 3.09 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.34 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |