C27H35NO6 — CID 14523272
tert-butyl (4S)-2,2-dimethyl-4-[(1S,2S)-3-oxo-1,2-bis(phenylmethoxy)propyl]-1,3-oxazolidine-3-carboxylate (PubChem CID 14523272) has the molecular formula C27H35NO6 and a molecular weight of 469.58 g/mol. Its IUPAC name is tert-butyl (4S)-2,2-dimethyl-4-[(1S,2S)-3-oxo-1,2-bis(phenylmethoxy)propyl]-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4S)-2,2-dimethyl-4-[(1S,2S)-3-oxo-1,2-bis(phenylmethoxy)propyl]-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 14523272 |
| Molecular Formula | C27H35NO6 |
| Molecular Weight | 469.58 g/mol |
| Exact Mass | 469.25 |
| IUPAC Name | tert-butyl (4S)-2,2-dimethyl-4-[(1S,2S)-3-oxo-1,2-bis(phenylmethoxy)propyl]-1,3-oxazolidine-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1[C@H]([C@H](OCc2ccccc2)[C@@H](C=O)OCc2ccccc2)COC1(C)C |
| InChI | InChI=1S/C27H35NO6/c1-26(2,3)34-25(30)28-22(19-33-27(28,4)5)24(32-18-21-14-10-7-11-15-21)23(16-29)31-17-20-12-8-6-9-13-20/h6-16,22-24H,17-19H2,1-5H3/t22-,23+,24-/m0/s1 |
| InChIKey | XKSNJKBOADBLEA-VXNXHJTFSA-N |
| XLogP | 4.73 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.58 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|