C22H35NO7S — CID 54598005
tert-butyl (4S)-2,2-dimethyl-4-[(1R)-4-methylsulfonyloxy-1-phenylmethoxybutyl]-1,3-oxazolidine-3-carboxylate (PubChem CID 54598005) has the molecular formula C22H35NO7S and a molecular weight of 457.59 g/mol. Its IUPAC name is tert-butyl (4S)-2,2-dimethyl-4-[(1R)-4-methylsulfonyloxy-1-phenylmethoxybutyl]-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4S)-2,2-dimethyl-4-[(1R)-4-methylsulfonyloxy-1-phenylmethoxybutyl]-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 54598005 |
| Molecular Formula | C22H35NO7S |
| Molecular Weight | 457.59 g/mol |
| Exact Mass | 457.21 |
| IUPAC Name | tert-butyl (4S)-2,2-dimethyl-4-[(1R)-4-methylsulfonyloxy-1-phenylmethoxybutyl]-1,3-oxazolidine-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1[C@H]([C@@H](CCCOS(C)(=O)=O)OCc2ccccc2)COC1(C)C |
| InChI | InChI=1S/C22H35NO7S/c1-21(2,3)30-20(24)23-18(16-28-22(23,4)5)19(13-10-14-29-31(6,25)26)27-15-17-11-8-7-9-12-17/h7-9,11-12,18-19H,10,13-16H2,1-6H3/t18-,19+/m0/s1 |
| InChIKey | LTZXFNZJQBUTFD-RBUKOAKNSA-N |
| XLogP | 3.70 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.59 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|