C22H37N2O6P — CID 12062931
tert-butyl (4S)-4-[(S)-(benzylamino)-diethoxyphosphorylmethyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 12062931) has the molecular formula C22H37N2O6P and a molecular weight of 456.52 g/mol. Its IUPAC name is tert-butyl (4S)-4-[(S)-(benzylamino)-diethoxyphosphorylmethyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4S)-4-[(S)-(benzylamino)-diethoxyphosphorylmethyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 12062931 |
| Molecular Formula | C22H37N2O6P |
| Molecular Weight | 456.52 g/mol |
| Exact Mass | 456.24 |
| IUPAC Name | tert-butyl (4S)-4-[(S)-(benzylamino)-diethoxyphosphorylmethyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | CCOP(=O)(OCC)[C@H](NCc1ccccc1)[C@@H]1COC(C)(C)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H37N2O6P/c1-8-28-31(26,29-9-2)19(23-15-17-13-11-10-12-14-17)18-16-27-22(6,7)24(18)20(25)30-21(3,4)5/h10-14,18-19,23H,8-9,15-16H2,1-7H3/t18-,19-/m0/s1 |
| InChIKey | GFSWFKJYVOJJHJ-OALUTQOASA-N |
| XLogP | 4.74 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.52 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|