C38H53NO7Si — CID 11422459
benzyl (2R,3S,5S,6S)-5-[tert-butyl(diphenyl)silyl]oxy-3-hydroxy-2-[(3S)-3-hydroxy-6-(methoxymethoxy)hexyl]-6-methylpiperidine-1-carboxylate (PubChem CID 11422459) has the molecular formula C38H53NO7Si and a molecular weight of 663.93 g/mol. Its IUPAC name is benzyl (2R,3S,5S,6S)-5-[tert-butyl(diphenyl)silyl]oxy-3-hydroxy-2-[(3S)-3-hydroxy-6-(methoxymethoxy)hexyl]-6-methylpiperidine-1-carboxylate.
| Compound Name | benzyl (2R,3S,5S,6S)-5-[tert-butyl(diphenyl)silyl]oxy-3-hydroxy-2-[(3S)-3-hydroxy-6-(methoxymethoxy)hexyl]-6-methylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 11422459 |
| Molecular Formula | C38H53NO7Si |
| Molecular Weight | 663.93 g/mol |
| Exact Mass | 663.36 |
| IUPAC Name | benzyl (2R,3S,5S,6S)-5-[tert-butyl(diphenyl)silyl]oxy-3-hydroxy-2-[(3S)-3-hydroxy-6-(methoxymethoxy)hexyl]-6-methylpiperidine-1-carboxylate |
| SMILES | COCOCCC[C@@H](O)CC[C@@H]1[C@@H](O)C[C@H](O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@H](C)N1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C38H53NO7Si/c1-29-36(46-47(38(2,3)4,32-19-11-7-12-20-32)33-21-13-8-14-22-33)26-35(41)34(24-23-31(40)18-15-25-44-28-43-5)39(29)37(42)45-27-30-16-9-6-10-17-30/h6-14,16-17,19-22,29,31,34-36,40-41H,15,18,23-28H2,1-5H3/t29-,31+,34+,35-,36-/m0/s1 |
| InChIKey | IDYGJNVGDGRTRZ-BVEYBVHQSA-N |
| XLogP | 5.63 |
| TPSA | 97.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.93 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|