C40H53NO5Si — CID 11365805
benzyl (2S,3S,6R)-3-[tert-butyl(diphenyl)silyl]oxy-6-[(E)-8-ethoxy-8-oxooct-6-enyl]-2-methylpiperidine-1-carboxylate (PubChem CID 11365805) has the molecular formula C40H53NO5Si and a molecular weight of 655.95 g/mol. Its IUPAC name is benzyl (2S,3S,6R)-3-[tert-butyl(diphenyl)silyl]oxy-6-[(E)-8-ethoxy-8-oxooct-6-enyl]-2-methylpiperidine-1-carboxylate.
| Compound Name | benzyl (2S,3S,6R)-3-[tert-butyl(diphenyl)silyl]oxy-6-[(E)-8-ethoxy-8-oxooct-6-enyl]-2-methylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 11365805 |
| Molecular Formula | C40H53NO5Si |
| Molecular Weight | 655.95 g/mol |
| Exact Mass | 655.37 |
| IUPAC Name | benzyl (2S,3S,6R)-3-[tert-butyl(diphenyl)silyl]oxy-6-[(E)-8-ethoxy-8-oxooct-6-enyl]-2-methylpiperidine-1-carboxylate |
| SMILES | CCOC(=O)/C=C/CCCCC[C@@H]1CC[C@H](O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@H](C)N1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C40H53NO5Si/c1-6-44-38(42)28-20-9-7-8-15-23-34-29-30-37(32(2)41(34)39(43)45-31-33-21-13-10-14-22-33)46-47(40(3,4)5,35-24-16-11-17-25-35)36-26-18-12-19-27-36/h10-14,16-22,24-28,32,34,37H,6-9,15,23,29-31H2,1-5H3/b28-20+/t32-,34+,37-/m0/s1 |
| InChIKey | GCIZOOOBNBUDEF-WHENFPSOSA-N |
| XLogP | 8.19 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.95 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|