C18H27NO3 — CID 11493240
benzyl (2R)-2-butyl-5-ethoxypyrrolidine-1-carboxylate (PubChem CID 11493240) has the molecular formula C18H27NO3 and a molecular weight of 305.42 g/mol. Its IUPAC name is benzyl (2R)-2-butyl-5-ethoxypyrrolidine-1-carboxylate.
| Compound Name | benzyl (2R)-2-butyl-5-ethoxypyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 11493240 |
| Molecular Formula | C18H27NO3 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.20 |
| IUPAC Name | benzyl (2R)-2-butyl-5-ethoxypyrrolidine-1-carboxylate |
| SMILES | CCCC[C@@H]1CCC(OCC)N1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C18H27NO3/c1-3-5-11-16-12-13-17(21-4-2)19(16)18(20)22-14-15-9-7-6-8-10-15/h6-10,16-17H,3-5,11-14H2,1-2H3/t16-,17?/m1/s1 |
| InChIKey | OWXFYJWKYYKIGC-TZHYSIJRSA-N |
| XLogP | 4.34 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |