C22H29NO6 — CID 102048859
benzyl (2S,5S)-2-(4,5-dioxoheptyl)-5-(2-methoxy-2-oxoethyl)pyrrolidine-1-carboxylate (PubChem CID 102048859) has the molecular formula C22H29NO6 and a molecular weight of 403.48 g/mol. Its IUPAC name is benzyl (2S,5S)-2-(4,5-dioxoheptyl)-5-(2-methoxy-2-oxoethyl)pyrrolidine-1-carboxylate.
| Compound Name | benzyl (2S,5S)-2-(4,5-dioxoheptyl)-5-(2-methoxy-2-oxoethyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 102048859 |
| Molecular Formula | C22H29NO6 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.20 |
| IUPAC Name | benzyl (2S,5S)-2-(4,5-dioxoheptyl)-5-(2-methoxy-2-oxoethyl)pyrrolidine-1-carboxylate |
| SMILES | CCC(=O)C(=O)CCC[C@H]1CC[C@@H](CC(=O)OC)N1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C22H29NO6/c1-3-19(24)20(25)11-7-10-17-12-13-18(14-21(26)28-2)23(17)22(27)29-15-16-8-5-4-6-9-16/h4-6,8-9,17-18H,3,7,10-15H2,1-2H3/t17-,18-/m0/s1 |
| InChIKey | SWULJLKKFVGUIP-ROUUACIJSA-N |
| XLogP | 3.44 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|