C41H63NO5Si — CID 25138418
tert-butyl (2S,3S,4aR,5S,8aS)-3-[tert-butyl(diphenyl)silyl]oxy-5-[(E,5S)-5-(methoxymethoxy)oct-2-enyl]-2-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carboxylate (PubChem CID 25138418) has the molecular formula C41H63NO5Si and a molecular weight of 678.04 g/mol. Its IUPAC name is tert-butyl (2S,3S,4aR,5S,8aS)-3-[tert-butyl(diphenyl)silyl]oxy-5-[(E,5S)-5-(methoxymethoxy)oct-2-enyl]-2-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carboxylate.
| Compound Name | tert-butyl (2S,3S,4aR,5S,8aS)-3-[tert-butyl(diphenyl)silyl]oxy-5-[(E,5S)-5-(methoxymethoxy)oct-2-enyl]-2-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carboxylate |
|---|---|
| PubChem CID | 25138418 |
| Molecular Formula | C41H63NO5Si |
| Molecular Weight | 678.04 g/mol |
| Exact Mass | 677.45 |
| IUPAC Name | tert-butyl (2S,3S,4aR,5S,8aS)-3-[tert-butyl(diphenyl)silyl]oxy-5-[(E,5S)-5-(methoxymethoxy)oct-2-enyl]-2-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carboxylate |
| SMILES | CCC[C@@H](C/C=C/C[C@@H]1CCC[C@H]2[C@@H]1C[C@H](O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@H](C)N2C(=O)OC(C)(C)C)OCOC |
| InChI | InChI=1S/C41H63NO5Si/c1-10-20-33(45-30-44-9)23-18-17-21-32-22-19-28-37-36(32)29-38(31(2)42(37)39(43)46-40(3,4)5)47-48(41(6,7)8,34-24-13-11-14-25-34)35-26-15-12-16-27-35/h11-18,24-27,31-33,36-38H,10,19-23,28-30H2,1-9H3/b18-17+/t31-,32+,33-,36+,37-,38-/m0/s1 |
| InChIKey | CNRMZFATUUISAT-VKBYGLOQSA-N |
| XLogP | 8.87 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.04 |
| LogP ≤ 5 | 8.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|