C32H39NO3Si — CID 134906044
2-[(1S,5S,6S,10R)-1-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-ethynyl-10-hydroxy-11-oxospiro[5.5]undecan-10-yl]acetonitrile (PubChem CID 134906044) has the molecular formula C32H39NO3Si and a molecular weight of 513.75 g/mol. Its IUPAC name is 2-[(1S,5S,6S,10R)-1-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-ethynyl-10-hydroxy-11-oxospiro[5.5]undecan-10-yl]acetonitrile.
| Compound Name | 2-[(1S,5S,6S,10R)-1-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-ethynyl-10-hydroxy-11-oxospiro[5.5]undecan-10-yl]acetonitrile |
|---|---|
| PubChem CID | 134906044 |
| Molecular Formula | C32H39NO3Si |
| Molecular Weight | 513.75 g/mol |
| Exact Mass | 513.27 |
| IUPAC Name | 2-[(1S,5S,6S,10R)-1-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-ethynyl-10-hydroxy-11-oxospiro[5.5]undecan-10-yl]acetonitrile |
| SMILES | C#C[C@@H]1CCC[C@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@]12CCC[C@@](O)(CC#N)C2=O |
| InChI | InChI=1S/C32H39NO3Si/c1-5-25-14-12-15-26(32(25)21-13-20-31(35,22-23-33)29(32)34)24-36-37(30(2,3)4,27-16-8-6-9-17-27)28-18-10-7-11-19-28/h1,6-11,16-19,25-26,35H,12-15,20-22,24H2,2-4H3/t25-,26-,31-,32+/m1/s1 |
| InChIKey | LBRFMBMINFIBDW-AFOZTUFKSA-N |
| XLogP | 5.00 |
| TPSA | 70.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.75 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|