C31H38O3Si — CID 10505114
(3R,4S,5S,9S)-9-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-ethynyl-2-oxadispiro[2.0.54.43]tridecan-13-one (PubChem CID 10505114) has the molecular formula C31H38O3Si and a molecular weight of 486.73 g/mol. Its IUPAC name is (3R,4S,5S,9S)-9-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-ethynyl-2-oxadispiro[2.0.54.43]tridecan-13-one.
| Compound Name | (3R,4S,5S,9S)-9-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-ethynyl-2-oxadispiro[2.0.54.43]tridecan-13-one |
|---|---|
| PubChem CID | 10505114 |
| Molecular Formula | C31H38O3Si |
| Molecular Weight | 486.73 g/mol |
| Exact Mass | 486.26 |
| IUPAC Name | (3R,4S,5S,9S)-9-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-ethynyl-2-oxadispiro[2.0.54.43]tridecan-13-one |
| SMILES | C#C[C@@H]1CCC[C@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@]12CCCC(=O)[C@]21CO1 |
| InChI | InChI=1S/C31H38O3Si/c1-5-24-14-12-15-25(30(24)21-13-20-28(32)31(30)23-33-31)22-34-35(29(2,3)4,26-16-8-6-9-17-26)27-18-10-7-11-19-27/h1,6-11,16-19,24-25H,12-15,20-23H2,2-4H3/t24-,25-,30+,31-/m1/s1 |
| InChIKey | YKOAPBNKTKXYTR-WMKNUWDHSA-N |
| XLogP | 5.12 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.73 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|