C30H41NOSi — CID 101482420
[(1'S,4S,9aR)-spiro[1,2,3,6,9,9a-hexahydroquinolizine-4,2'-cyclopentane]-1'-yl]methoxy-tert-butyl-diphenylsilane (PubChem CID 101482420) has the molecular formula C30H41NOSi and a molecular weight of 459.75 g/mol. Its IUPAC name is [(1'S,4S,9aR)-spiro[1,2,3,6,9,9a-hexahydroquinolizine-4,2'-cyclopentane]-1'-yl]methoxy-tert-butyl-diphenylsilane.
| Compound Name | [(1'S,4S,9aR)-spiro[1,2,3,6,9,9a-hexahydroquinolizine-4,2'-cyclopentane]-1'-yl]methoxy-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 101482420 |
| Molecular Formula | C30H41NOSi |
| Molecular Weight | 459.75 g/mol |
| Exact Mass | 459.30 |
| IUPAC Name | [(1'S,4S,9aR)-spiro[1,2,3,6,9,9a-hexahydroquinolizine-4,2'-cyclopentane]-1'-yl]methoxy-tert-butyl-diphenylsilane |
| SMILES | CC(C)(C)[Si](OC[C@H]1CCC[C@]12CCC[C@@H]1CC=CCN12)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H41NOSi/c1-29(2,3)33(27-17-6-4-7-18-27,28-19-8-5-9-20-28)32-24-25-14-12-21-30(25)22-13-16-26-15-10-11-23-31(26)30/h4-11,17-20,25-26H,12-16,21-24H2,1-3H3/t25-,26+,30+/m1/s1 |
| InChIKey | WUCZUDLOPMMMAI-YIIWZEITSA-N |
| XLogP | 5.92 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.75 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|