C31H42N2O5SSi — CID 58623985
ethyl 3-[3-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-5-(2-ethoxyethyl)-4-oxo-1,3-thiazolidin-2-yl]-2-cyanopropanoate (PubChem CID 58623985) has the molecular formula C31H42N2O5SSi and a molecular weight of 582.84 g/mol. Its IUPAC name is ethyl 3-[3-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-5-(2-ethoxyethyl)-4-oxo-1,3-thiazolidin-2-yl]-2-cyanopropanoate.
| Compound Name | ethyl 3-[3-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-5-(2-ethoxyethyl)-4-oxo-1,3-thiazolidin-2-yl]-2-cyanopropanoate |
|---|---|
| PubChem CID | 58623985 |
| Molecular Formula | C31H42N2O5SSi |
| Molecular Weight | 582.84 g/mol |
| Exact Mass | 582.26 |
| IUPAC Name | ethyl 3-[3-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-5-(2-ethoxyethyl)-4-oxo-1,3-thiazolidin-2-yl]-2-cyanopropanoate |
| SMILES | CCOCCC1SC(CC(C#N)C(=O)OCC)N(CCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C1=O |
| InChI | InChI=1S/C31H42N2O5SSi/c1-6-36-20-18-27-29(34)33(28(39-27)22-24(23-32)30(35)37-7-2)19-21-38-40(31(3,4)5,25-14-10-8-11-15-25)26-16-12-9-13-17-26/h8-17,24,27-28H,6-7,18-22H2,1-5H3 |
| InChIKey | MNUWRQKYTKNSRJ-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 88.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.84 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|