C26H30N2O4SSi — CID 142670608
ethyl 2-[3-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-4-oxo-1,3-thiazolidin-2-ylidene]-2-cyanoacetate (PubChem CID 142670608) has the molecular formula C26H30N2O4SSi and a molecular weight of 494.69 g/mol. Its IUPAC name is ethyl 2-[3-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-4-oxo-1,3-thiazolidin-2-ylidene]-2-cyanoacetate.
| Compound Name | ethyl 2-[3-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-4-oxo-1,3-thiazolidin-2-ylidene]-2-cyanoacetate |
|---|---|
| PubChem CID | 142670608 |
| Molecular Formula | C26H30N2O4SSi |
| Molecular Weight | 494.69 g/mol |
| Exact Mass | 494.17 |
| IUPAC Name | ethyl 2-[3-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-4-oxo-1,3-thiazolidin-2-ylidene]-2-cyanoacetate |
| SMILES | CCOC(=O)C(C#N)=C1SCC(=O)N1CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C26H30N2O4SSi/c1-5-31-25(30)22(18-27)24-28(23(29)19-33-24)16-17-32-34(26(2,3)4,20-12-8-6-9-13-20)21-14-10-7-11-15-21/h6-15H,5,16-17,19H2,1-4H3 |
| InChIKey | JCLMERJSPZTSJJ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 79.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.69 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|