C21H23NO2Si — CID 134889501
(E)-4-[tert-butyl(diphenyl)silyl]oxy-2-formylbut-2-enenitrile (PubChem CID 134889501) has the molecular formula C21H23NO2Si and a molecular weight of 349.51 g/mol. Its IUPAC name is (E)-4-[tert-butyl(diphenyl)silyl]oxy-2-formylbut-2-enenitrile.
| Compound Name | (E)-4-[tert-butyl(diphenyl)silyl]oxy-2-formylbut-2-enenitrile |
|---|---|
| PubChem CID | 134889501 |
| Molecular Formula | C21H23NO2Si |
| Molecular Weight | 349.51 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | (E)-4-[tert-butyl(diphenyl)silyl]oxy-2-formylbut-2-enenitrile |
| SMILES | CC(C)(C)[Si](OC/C=C(\C#N)C=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H23NO2Si/c1-21(2,3)25(19-10-6-4-7-11-19,20-12-8-5-9-13-20)24-15-14-18(16-22)17-23/h4-14,17H,15H2,1-3H3/b18-14+ |
| InChIKey | CBRIFSTXZGIASD-NBVRZTHBSA-N |
| XLogP | 3.21 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.51 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|