C25H27BrO3Si — CID 71682556
(5Z)-3-bromo-5-[(E)-4-[tert-butyl(diphenyl)silyl]oxy-2-methylbut-2-enylidene]furan-2-one (PubChem CID 71682556) has the molecular formula C25H27BrO3Si and a molecular weight of 483.48 g/mol. Its IUPAC name is (5Z)-3-bromo-5-[(E)-4-[tert-butyl(diphenyl)silyl]oxy-2-methylbut-2-enylidene]furan-2-one.
| Compound Name | (5Z)-3-bromo-5-[(E)-4-[tert-butyl(diphenyl)silyl]oxy-2-methylbut-2-enylidene]furan-2-one |
|---|---|
| PubChem CID | 71682556 |
| Molecular Formula | C25H27BrO3Si |
| Molecular Weight | 483.48 g/mol |
| Exact Mass | 482.09 |
| IUPAC Name | (5Z)-3-bromo-5-[(E)-4-[tert-butyl(diphenyl)silyl]oxy-2-methylbut-2-enylidene]furan-2-one |
| SMILES | CC(/C=C1/C=C(Br)C(=O)O1)=C\CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C25H27BrO3Si/c1-19(17-20-18-23(26)24(27)29-20)15-16-28-30(25(2,3)4,21-11-7-5-8-12-21)22-13-9-6-10-14-22/h5-15,17-18H,16H2,1-4H3/b19-15+,20-17- |
| InChIKey | ZTALKJRSZJUZQP-YKZVWFMFSA-N |
| XLogP | 5.23 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.48 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|