C27H30O4Si — CID 23243573
(5E)-5-[(E)-4-[tert-butyl(diphenyl)silyl]oxybut-2-enylidene]-3-[(E)-3-hydroxyprop-1-enyl]furan-2-one (PubChem CID 23243573) has the molecular formula C27H30O4Si and a molecular weight of 446.62 g/mol. Its IUPAC name is (5E)-5-[(E)-4-[tert-butyl(diphenyl)silyl]oxybut-2-enylidene]-3-[(E)-3-hydroxyprop-1-enyl]furan-2-one.
| Compound Name | (5E)-5-[(E)-4-[tert-butyl(diphenyl)silyl]oxybut-2-enylidene]-3-[(E)-3-hydroxyprop-1-enyl]furan-2-one |
|---|---|
| PubChem CID | 23243573 |
| Molecular Formula | C27H30O4Si |
| Molecular Weight | 446.62 g/mol |
| Exact Mass | 446.19 |
| IUPAC Name | (5E)-5-[(E)-4-[tert-butyl(diphenyl)silyl]oxybut-2-enylidene]-3-[(E)-3-hydroxyprop-1-enyl]furan-2-one |
| SMILES | CC(C)(C)[Si](OC/C=C/C=C1\C=C(/C=C/CO)C(=O)O1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H30O4Si/c1-27(2,3)32(24-15-6-4-7-16-24,25-17-8-5-9-18-25)30-20-11-10-14-23-21-22(13-12-19-28)26(29)31-23/h4-18,21,28H,19-20H2,1-3H3/b11-10+,13-12+,23-14+ |
| InChIKey | PQJHPAUWGWPGKJ-LZTYCBFESA-N |
| XLogP | 4.03 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.62 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|