C31H42O4Si — CID 25228856
methyl 3-[2-[5-[tert-butyl(diphenyl)silyl]oxypentyl]-6-oxocyclohexen-1-yl]propanoate (PubChem CID 25228856) has the molecular formula C31H42O4Si and a molecular weight of 506.76 g/mol. Its IUPAC name is methyl 3-[2-[5-[tert-butyl(diphenyl)silyl]oxypentyl]-6-oxocyclohexen-1-yl]propanoate.
| Compound Name | methyl 3-[2-[5-[tert-butyl(diphenyl)silyl]oxypentyl]-6-oxocyclohexen-1-yl]propanoate |
|---|---|
| PubChem CID | 25228856 |
| Molecular Formula | C31H42O4Si |
| Molecular Weight | 506.76 g/mol |
| Exact Mass | 506.29 |
| IUPAC Name | methyl 3-[2-[5-[tert-butyl(diphenyl)silyl]oxypentyl]-6-oxocyclohexen-1-yl]propanoate |
| SMILES | COC(=O)CCC1=C(CCCCCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)CCCC1=O |
| InChI | InChI=1S/C31H42O4Si/c1-31(2,3)36(26-17-9-5-10-18-26,27-19-11-6-12-20-27)35-24-13-7-8-15-25-16-14-21-29(32)28(25)22-23-30(33)34-4/h5-6,9-12,17-20H,7-8,13-16,21-24H2,1-4H3 |
| InChIKey | APULBJUMNUKAAA-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.76 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|