C31H49NO3Si — CID 10984064
methyl 9-[2-[tert-butyl(diphenyl)silyl]oxyethylamino]dodecanoate (PubChem CID 10984064) has the molecular formula C31H49NO3Si and a molecular weight of 511.82 g/mol. Its IUPAC name is methyl 9-[2-[tert-butyl(diphenyl)silyl]oxyethylamino]dodecanoate.
| Compound Name | methyl 9-[2-[tert-butyl(diphenyl)silyl]oxyethylamino]dodecanoate |
|---|---|
| PubChem CID | 10984064 |
| Molecular Formula | C31H49NO3Si |
| Molecular Weight | 511.82 g/mol |
| Exact Mass | 511.35 |
| IUPAC Name | methyl 9-[2-[tert-butyl(diphenyl)silyl]oxyethylamino]dodecanoate |
| SMILES | CCCC(CCCCCCCC(=O)OC)NCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C31H49NO3Si/c1-6-18-27(19-12-8-7-9-17-24-30(33)34-5)32-25-26-35-36(31(2,3)4,28-20-13-10-14-21-28)29-22-15-11-16-23-29/h10-11,13-16,20-23,27,32H,6-9,12,17-19,24-26H2,1-5H3 |
| InChIKey | SGMASXGZVOTJOS-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.82 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|