C28H41NO3Si — CID 158535558
N-[5-[tert-butyl(diphenyl)silyl]oxypentyl]-2-oxoheptanamide (PubChem CID 158535558) has the molecular formula C28H41NO3Si and a molecular weight of 467.73 g/mol. Its IUPAC name is N-[5-[tert-butyl(diphenyl)silyl]oxypentyl]-2-oxoheptanamide.
| Compound Name | N-[5-[tert-butyl(diphenyl)silyl]oxypentyl]-2-oxoheptanamide |
|---|---|
| PubChem CID | 158535558 |
| Molecular Formula | C28H41NO3Si |
| Molecular Weight | 467.73 g/mol |
| Exact Mass | 467.29 |
| IUPAC Name | N-[5-[tert-butyl(diphenyl)silyl]oxypentyl]-2-oxoheptanamide |
| SMILES | CCCCCC(=O)C(=O)NCCCCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C28H41NO3Si/c1-5-6-10-21-26(30)27(31)29-22-15-9-16-23-32-33(28(2,3)4,24-17-11-7-12-18-24)25-19-13-8-14-20-25/h7-8,11-14,17-20H,5-6,9-10,15-16,21-23H2,1-4H3,(H,29,31) |
| InChIKey | WILIIKDGNMRUON-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.73 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|