C46H79BrN2O3Si — CID 158723430
N-(5-bromopentyl)-N-propan-2-ylheptanamide;N-[5-[tert-butyl(diphenyl)silyl]oxypentyl]-N-propan-2-ylheptanamide (PubChem CID 158723430) has the molecular formula C46H79BrN2O3Si and a molecular weight of 816.14 g/mol. Its IUPAC name is N-(5-bromopentyl)-N-propan-2-ylheptanamide;N-[5-[tert-butyl(diphenyl)silyl]oxypentyl]-N-propan-2-ylheptanamide.
| Compound Name | N-(5-bromopentyl)-N-propan-2-ylheptanamide;N-[5-[tert-butyl(diphenyl)silyl]oxypentyl]-N-propan-2-ylheptanamide |
|---|---|
| PubChem CID | 158723430 |
| Molecular Formula | C46H79BrN2O3Si |
| Molecular Weight | 816.14 g/mol |
| Exact Mass | 814.50 |
| IUPAC Name | N-(5-bromopentyl)-N-propan-2-ylheptanamide;N-[5-[tert-butyl(diphenyl)silyl]oxypentyl]-N-propan-2-ylheptanamide |
| SMILES | CCCCCCC(=O)N(CCCCCBr)C(C)C.CCCCCCC(=O)N(CCCCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C(C)C |
| InChI | InChI=1S/C31H49NO2Si.C15H30BrNO/c1-7-8-9-17-24-30(33)32(27(2)3)25-18-12-19-26-34-35(31(4,5)6,28-20-13-10-14-21-28)29-22-15-11-16-23-29;1-4-5-6-8-11-15(18)17(14(2)3)13-10-7-9-12-16/h10-11,13-16,20-23,27H,7-9,12,17-19,24-26H2,1-6H3;14H,4-13H2,1-3H3 |
| InChIKey | IKEWAZJRWFENQG-UHFFFAOYSA-N |
| XLogP | 11.70 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 816.14 |
| LogP ≤ 5 | 11.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|