C68H121NO5S2Si — CID 171487419
[7-[4-[tert-butyl(diphenyl)silyl]oxybutyl-methylamino]-12-decanoyloxy-1,13-bis(heptylsulfanyl)tridecan-2-yl] decanoate (PubChem CID 171487419) has the molecular formula C68H121NO5S2Si and a molecular weight of 1124.94 g/mol. Its IUPAC name is [7-[4-[tert-butyl(diphenyl)silyl]oxybutyl-methylamino]-12-decanoyloxy-1,13-bis(heptylsulfanyl)tridecan-2-yl] decanoate.
| Compound Name | [7-[4-[tert-butyl(diphenyl)silyl]oxybutyl-methylamino]-12-decanoyloxy-1,13-bis(heptylsulfanyl)tridecan-2-yl] decanoate |
|---|---|
| PubChem CID | 171487419 |
| Molecular Formula | C68H121NO5S2Si |
| Molecular Weight | 1124.94 g/mol |
| Exact Mass | 1123.85 |
| IUPAC Name | [7-[4-[tert-butyl(diphenyl)silyl]oxybutyl-methylamino]-12-decanoyloxy-1,13-bis(heptylsulfanyl)tridecan-2-yl] decanoate |
| SMILES | CCCCCCCCCC(=O)OC(CCCCC(CCCCC(CSCCCCCCC)OC(=O)CCCCCCCCC)N(C)CCCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)CSCCCCCCC |
| InChI | InChI=1S/C68H121NO5S2Si/c1-9-13-17-21-23-25-35-53-66(70)73-62(59-75-57-43-27-19-15-11-3)47-39-37-45-61(46-38-40-48-63(60-76-58-44-28-20-16-12-4)74-67(71)54-36-26-24-22-18-14-10-2)69(8)55-41-42-56-72-77(68(5,6)7,64-49-31-29-32-50-64)65-51-33-30-34-52-65/h29-34,49-52,61-63H,9-28,35-48,53-60H2,1-8H3 |
| InChIKey | INWVQQRUUJCHBN-UHFFFAOYSA-N |
| XLogP | 19.28 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 53 |
| Heavy Atoms | 77 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1124.94 |
| LogP ≤ 5 | 19.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|