C62H105NO9Si — CID 175625268
[4-[3-[2-[tert-butyl(diphenyl)silyl]oxyethyl-methylamino]-2-[4-(2-hexyldecanoyloxy)butanoyloxy]propoxy]-4-oxobutyl] 2-hexyldecanoate (PubChem CID 175625268) has the molecular formula C62H105NO9Si and a molecular weight of 1036.61 g/mol. Its IUPAC name is [4-[3-[2-[tert-butyl(diphenyl)silyl]oxyethyl-methylamino]-2-[4-(2-hexyldecanoyloxy)butanoyloxy]propoxy]-4-oxobutyl] 2-hexyldecanoate.
| Compound Name | [4-[3-[2-[tert-butyl(diphenyl)silyl]oxyethyl-methylamino]-2-[4-(2-hexyldecanoyloxy)butanoyloxy]propoxy]-4-oxobutyl] 2-hexyldecanoate |
|---|---|
| PubChem CID | 175625268 |
| Molecular Formula | C62H105NO9Si |
| Molecular Weight | 1036.61 g/mol |
| Exact Mass | 1035.76 |
| IUPAC Name | [4-[3-[2-[tert-butyl(diphenyl)silyl]oxyethyl-methylamino]-2-[4-(2-hexyldecanoyloxy)butanoyloxy]propoxy]-4-oxobutyl] 2-hexyldecanoate |
| SMILES | CCCCCCCCC(CCCCCC)C(=O)OCCCC(=O)OCC(CN(C)CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)OC(=O)CCCOC(=O)C(CCCCCC)CCCCCCCC |
| InChI | InChI=1S/C62H105NO9Si/c1-9-13-17-21-23-29-39-53(37-27-19-15-11-3)60(66)68-48-35-45-58(64)70-52-55(72-59(65)46-36-49-69-61(67)54(38-28-20-16-12-4)40-30-24-22-18-14-10-2)51-63(8)47-50-71-73(62(5,6)7,56-41-31-25-32-42-56)57-43-33-26-34-44-57/h25-26,31-34,41-44,53-55H,9-24,27-30,35-40,45-52H2,1-8H3 |
| InChIKey | UYBGWUWLPOLGAS-UHFFFAOYSA-N |
| XLogP | 14.27 |
| TPSA | 117.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 45 |
| Heavy Atoms | 73 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1036.61 |
| LogP ≤ 5 | 14.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|