C66H117NO5S2Si — CID 171487357
[11-[3,4-bis(heptylsulfanyl)butanoyloxy]-6-[4-[tert-butyl(diphenyl)silyl]oxybutyl-methylamino]undecyl] 2-hexyldecanoate (PubChem CID 171487357) has the molecular formula C66H117NO5S2Si and a molecular weight of 1096.88 g/mol. Its IUPAC name is [11-[3,4-bis(heptylsulfanyl)butanoyloxy]-6-[4-[tert-butyl(diphenyl)silyl]oxybutyl-methylamino]undecyl] 2-hexyldecanoate.
| Compound Name | [11-[3,4-bis(heptylsulfanyl)butanoyloxy]-6-[4-[tert-butyl(diphenyl)silyl]oxybutyl-methylamino]undecyl] 2-hexyldecanoate |
|---|---|
| PubChem CID | 171487357 |
| Molecular Formula | C66H117NO5S2Si |
| Molecular Weight | 1096.88 g/mol |
| Exact Mass | 1095.81 |
| IUPAC Name | [11-[3,4-bis(heptylsulfanyl)butanoyloxy]-6-[4-[tert-butyl(diphenyl)silyl]oxybutyl-methylamino]undecyl] 2-hexyldecanoate |
| SMILES | CCCCCCCCC(CCCCCC)C(=O)OCCCCCC(CCCCCOC(=O)CC(CSCCCCCCC)SCCCCCCC)N(C)CCCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C66H117NO5S2Si/c1-9-13-17-21-22-30-44-59(43-29-20-16-12-4)65(69)71-53-39-28-32-46-60(67(8)51-37-40-54-72-75(66(5,6)7,62-47-33-25-34-48-62)63-49-35-26-36-50-63)45-31-27-38-52-70-64(68)57-61(74-56-42-24-19-15-11-3)58-73-55-41-23-18-14-10-2/h25-26,33-36,47-50,59-61H,9-24,27-32,37-46,51-58H2,1-8H3 |
| InChIKey | QAQXPJGREMZCML-UHFFFAOYSA-N |
| XLogP | 18.35 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 51 |
| Heavy Atoms | 75 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1096.88 |
| LogP ≤ 5 | 18.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|