C63H111NO5S2Si — CID 171487369
[7-[4-[tert-butyl(diphenyl)silyl]oxybutylamino]-12-decanoyloxy-1,13-bis(pentylsulfanyl)tridecan-2-yl] decanoate (PubChem CID 171487369) has the molecular formula C63H111NO5S2Si and a molecular weight of 1054.80 g/mol. Its IUPAC name is [7-[4-[tert-butyl(diphenyl)silyl]oxybutylamino]-12-decanoyloxy-1,13-bis(pentylsulfanyl)tridecan-2-yl] decanoate.
| Compound Name | [7-[4-[tert-butyl(diphenyl)silyl]oxybutylamino]-12-decanoyloxy-1,13-bis(pentylsulfanyl)tridecan-2-yl] decanoate |
|---|---|
| PubChem CID | 171487369 |
| Molecular Formula | C63H111NO5S2Si |
| Molecular Weight | 1054.80 g/mol |
| Exact Mass | 1053.77 |
| IUPAC Name | [7-[4-[tert-butyl(diphenyl)silyl]oxybutylamino]-12-decanoyloxy-1,13-bis(pentylsulfanyl)tridecan-2-yl] decanoate |
| SMILES | CCCCCCCCCC(=O)OC(CCCCC(CCCCC(CSCCCCC)OC(=O)CCCCCCCCC)NCCCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)CSCCCCC |
| InChI | InChI=1S/C63H111NO5S2Si/c1-8-12-16-18-20-22-30-48-61(65)68-57(54-70-52-38-14-10-3)42-34-32-40-56(41-33-35-43-58(55-71-53-39-15-11-4)69-62(66)49-31-23-21-19-17-13-9-2)64-50-36-37-51-67-72(63(5,6)7,59-44-26-24-27-45-59)60-46-28-25-29-47-60/h24-29,44-47,56-58,64H,8-23,30-43,48-55H2,1-7H3 |
| InChIKey | SKLZVJUSDGTGOF-UHFFFAOYSA-N |
| XLogP | 17.37 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 49 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1054.80 |
| LogP ≤ 5 | 17.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|