C59H103NO5S2Si — CID 171487304
[11-[2,2-bis(pentylsulfanyl)acetyl]oxy-6-[4-[tert-butyl(diphenyl)silyl]oxybutylamino]undecyl] 2-hexyldecanoate (PubChem CID 171487304) has the molecular formula C59H103NO5S2Si and a molecular weight of 998.69 g/mol. Its IUPAC name is [11-[2,2-bis(pentylsulfanyl)acetyl]oxy-6-[4-[tert-butyl(diphenyl)silyl]oxybutylamino]undecyl] 2-hexyldecanoate.
| Compound Name | [11-[2,2-bis(pentylsulfanyl)acetyl]oxy-6-[4-[tert-butyl(diphenyl)silyl]oxybutylamino]undecyl] 2-hexyldecanoate |
|---|---|
| PubChem CID | 171487304 |
| Molecular Formula | C59H103NO5S2Si |
| Molecular Weight | 998.69 g/mol |
| Exact Mass | 997.70 |
| IUPAC Name | [11-[2,2-bis(pentylsulfanyl)acetyl]oxy-6-[4-[tert-butyl(diphenyl)silyl]oxybutylamino]undecyl] 2-hexyldecanoate |
| SMILES | CCCCCCCCC(CCCCCC)C(=O)OCCCCCC(CCCCCOC(=O)C(SCCCCC)SCCCCC)NCCCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C59H103NO5S2Si/c1-8-12-16-18-19-25-39-52(38-24-17-13-9-2)56(61)63-47-33-22-26-40-53(41-27-23-34-48-64-57(62)58(66-50-36-14-10-3)67-51-37-15-11-4)60-46-32-35-49-65-68(59(5,6)7,54-42-28-20-29-43-54)55-44-30-21-31-45-55/h20-21,28-31,42-45,52-53,58,60H,8-19,22-27,32-41,46-51H2,1-7H3 |
| InChIKey | KVDKISZGHQLIIF-UHFFFAOYSA-N |
| XLogP | 16.02 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 45 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 998.69 |
| LogP ≤ 5 | 16.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|