C65H106O7Si — CID 172523169
heptadecan-9-yl 8-[3-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-(8-nonoxy-8-oxooctoxy)phenoxy]octanoate (PubChem CID 172523169) has the molecular formula C65H106O7Si and a molecular weight of 1027.64 g/mol. Its IUPAC name is heptadecan-9-yl 8-[3-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-(8-nonoxy-8-oxooctoxy)phenoxy]octanoate.
| Compound Name | heptadecan-9-yl 8-[3-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-(8-nonoxy-8-oxooctoxy)phenoxy]octanoate |
|---|---|
| PubChem CID | 172523169 |
| Molecular Formula | C65H106O7Si |
| Molecular Weight | 1027.64 g/mol |
| Exact Mass | 1026.77 |
| IUPAC Name | heptadecan-9-yl 8-[3-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-(8-nonoxy-8-oxooctoxy)phenoxy]octanoate |
| SMILES | CCCCCCCCCOC(=O)CCCCCCCOc1ccc(OCCCCCCCC(=O)OC(CCCCCCCC)CCCCCCCC)cc1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C65H106O7Si/c1-7-10-13-16-19-26-41-54-70-63(66)48-37-24-20-28-40-53-69-62-51-50-59(55-57(62)56-71-73(65(4,5)6,60-44-33-29-34-45-60)61-46-35-30-36-47-61)68-52-39-27-21-25-38-49-64(67)72-58(42-31-22-17-14-11-8-2)43-32-23-18-15-12-9-3/h29-30,33-36,44-47,50-51,55,58H,7-28,31-32,37-43,48-49,52-54,56H2,1-6H3 |
| InChIKey | HGXKTGZHMHKZLQ-UHFFFAOYSA-N |
| XLogP | 17.91 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 46 |
| Heavy Atoms | 73 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1027.64 |
| LogP ≤ 5 | 17.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|