C40H58O5Si — CID 172523173
nonyl 8-[2-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-hydroxyphenoxy]octanoate (PubChem CID 172523173) has the molecular formula C40H58O5Si and a molecular weight of 646.98 g/mol. Its IUPAC name is nonyl 8-[2-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-hydroxyphenoxy]octanoate.
| Compound Name | nonyl 8-[2-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-hydroxyphenoxy]octanoate |
|---|---|
| PubChem CID | 172523173 |
| Molecular Formula | C40H58O5Si |
| Molecular Weight | 646.98 g/mol |
| Exact Mass | 646.41 |
| IUPAC Name | nonyl 8-[2-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-hydroxyphenoxy]octanoate |
| SMILES | CCCCCCCCCOC(=O)CCCCCCCOc1ccc(O)cc1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C40H58O5Si/c1-5-6-7-8-9-12-22-31-44-39(42)27-20-11-10-13-21-30-43-38-29-28-35(41)32-34(38)33-45-46(40(2,3)4,36-23-16-14-17-24-36)37-25-18-15-19-26-37/h14-19,23-26,28-29,32,41H,5-13,20-22,27,30-31,33H2,1-4H3 |
| InChIKey | VURUEBKQECFQTP-UHFFFAOYSA-N |
| XLogP | 9.48 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.98 |
| LogP ≤ 5 | 9.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|