C51H100N2O6 — CID 171487511
[11-[2-[2-hexyldecanoyl(methyl)amino]acetyl]oxy-6-[4-hydroxybutyl(methyl)amino]undecyl] 2-hexyldecanoate (PubChem CID 171487511) has the molecular formula C51H100N2O6 and a molecular weight of 837.37 g/mol. Its IUPAC name is [11-[2-[2-hexyldecanoyl(methyl)amino]acetyl]oxy-6-[4-hydroxybutyl(methyl)amino]undecyl] 2-hexyldecanoate.
| Compound Name | [11-[2-[2-hexyldecanoyl(methyl)amino]acetyl]oxy-6-[4-hydroxybutyl(methyl)amino]undecyl] 2-hexyldecanoate |
|---|---|
| PubChem CID | 171487511 |
| Molecular Formula | C51H100N2O6 |
| Molecular Weight | 837.37 g/mol |
| Exact Mass | 836.76 |
| IUPAC Name | [11-[2-[2-hexyldecanoyl(methyl)amino]acetyl]oxy-6-[4-hydroxybutyl(methyl)amino]undecyl] 2-hexyldecanoate |
| SMILES | CCCCCCCCC(CCCCCC)C(=O)OCCCCCC(CCCCCOC(=O)CN(C)C(=O)C(CCCCCC)CCCCCCCC)N(C)CCCCO |
| InChI | InChI=1S/C51H100N2O6/c1-7-11-15-19-21-27-36-46(35-25-17-13-9-3)50(56)53(6)45-49(55)58-43-33-23-29-39-48(52(5)41-31-32-42-54)40-30-24-34-44-59-51(57)47(37-26-18-14-10-4)38-28-22-20-16-12-8-2/h46-48,54H,7-45H2,1-6H3 |
| InChIKey | CSJBEWNAZPRVTI-UHFFFAOYSA-N |
| XLogP | 13.40 |
| TPSA | 96.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 45 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 837.37 |
| LogP ≤ 5 | 13.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|