About [11-[2-[2-hexyldecanoyl(methyl)amino]acetyl]oxy-6-oxoundecyl] 3-hexylundecanoate
[11-[2-[2-hexyldecanoyl(methyl)amino]acetyl]oxy-6-oxoundecyl] 3-hexylundecanoate (PubChem CID 171487524) has the molecular formula C47H89NO6
and a molecular weight of 764.23 g/mol. Its IUPAC name is [11-[2-[2-hexyldecanoyl(methyl)amino]acetyl]oxy-6-oxoundecyl] 3-hexylundecanoate.
Molecular Properties
| Compound Name | [11-[2-[2-hexyldecanoyl(methyl)amino]acetyl]oxy-6-oxoundecyl] 3-hexylundecanoate |
| PubChem CID | 171487524 |
| Molecular Formula | C47H89NO6 |
| Molecular Weight | 764.23 g/mol |
| Exact Mass | 763.67 |
| IUPAC Name | [11-[2-[2-hexyldecanoyl(methyl)amino]acetyl]oxy-6-oxoundecyl] 3-hexylundecanoate |
| SMILES | CCCCCCCCC(CCCCCC)CC(=O)OCCCCCC(=O)CCCCCOC(=O)CN(C)C(=O)C(CCCCCC)CCCCCCCC |
| InChI | InChI=1S/C47H89NO6/c1-6-10-14-18-20-25-33-42(32-24-16-12-8-3)40-45(50)53-38-30-22-28-36-44(49)37-29-23-31-39-54-46(51)41-48(5)47(52)43(34-26-17-13-9-4)35-27-21-19-15-11-7-2/h42-43H,6-41H2,1-5H3 |
| InChIKey | YJKHFTPKKQJTNO-UHFFFAOYSA-N |
| XLogP | 13.29 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 41 |
| Heavy Atoms | 54 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 764.23 |
| LogP ≤ 5 | 13.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [11-[2-[2-hexyldecanoyl(methyl)amino]acetyl]oxy-6-oxoundecyl] 3-hexylundecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [11-[2-[2-hexyldecanoyl(methyl)amino]acetyl]oxy-6-oxoundecyl] 3-hexylundecanoate?
The IUPAC name of [11-[2-[2-hexyldecanoyl(methyl)amino]acetyl]oxy-6-oxoundecyl] 3-hexylundecanoate (CID 171487524) is [11-[2-[2-hexyldecanoyl(methyl)amino]acetyl]oxy-6-oxoundecyl] 3-hexylundecanoate.
What is the SMILES notation for [11-[2-[2-hexyldecanoyl(methyl)amino]acetyl]oxy-6-oxoundecyl] 3-hexylundecanoate?
The canonical SMILES for [11-[2-[2-hexyldecanoyl(methyl)amino]acetyl]oxy-6-oxoundecyl] 3-hexylundecanoate is CCCCCCCCC(CCCCCC)CC(=O)OCCCCCC(=O)CCCCCOC(=O)CN(C)C(=O)C(CCCCCC)CCCCCCCC.
What is the InChIKey of [11-[2-[2-hexyldecanoyl(methyl)amino]acetyl]oxy-6-oxoundecyl] 3-hexylundecanoate?
The InChIKey is YJKHFTPKKQJTNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C47H89NO6/c1-6-10-14-18-20-25-33-42(32-24-16-12-8-3)40-45(50)53-38-30-22-28-36-44(49)37-29-23-31-39-54-46(51)41-48(5)47(52)43(34-26-17-13-9-4)35-27-21-19-15-11-7-2/h42-43H,6-41H2,1-5H3.
What are the key properties of [11-[2-[2-hexyldecanoyl(methyl)amino]acetyl]oxy-6-oxoundecyl] 3-hexylundecanoate?
[11-[2-[2-hexyldecanoyl(methyl)amino]acetyl]oxy-6-oxoundecyl] 3-hexylundecanoate has a molecular weight of 764.23 g/mol, XLogP of 13.29, 41 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [11-[2-[2-hexyldecanoyl(methyl)amino]acetyl]oxy-6-oxoundecyl] 3-hexylundecanoate is sourced from PubChem (CID 171487524), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).