C50H99NO5S2 — CID 171811931
1-[6-[4-hydroxybutyl(methyl)amino]-11-(2-nonanoyloxyoctylsulfanyl)undecyl]sulfanyloctan-2-yl nonanoate (PubChem CID 171811931) has the molecular formula C50H99NO5S2 and a molecular weight of 858.48 g/mol. Its IUPAC name is 1-[6-[4-hydroxybutyl(methyl)amino]-11-(2-nonanoyloxyoctylsulfanyl)undecyl]sulfanyloctan-2-yl nonanoate.
| Compound Name | 1-[6-[4-hydroxybutyl(methyl)amino]-11-(2-nonanoyloxyoctylsulfanyl)undecyl]sulfanyloctan-2-yl nonanoate |
|---|---|
| PubChem CID | 171811931 |
| Molecular Formula | C50H99NO5S2 |
| Molecular Weight | 858.48 g/mol |
| Exact Mass | 857.70 |
| IUPAC Name | 1-[6-[4-hydroxybutyl(methyl)amino]-11-(2-nonanoyloxyoctylsulfanyl)undecyl]sulfanyloctan-2-yl nonanoate |
| SMILES | CCCCCCCCC(=O)OC(CCCCCC)CSCCCCCC(CCCCCSCC(CCCCCC)OC(=O)CCCCCCCC)N(C)CCCCO |
| InChI | InChI=1S/C50H99NO5S2/c1-6-10-14-18-20-28-38-49(53)55-47(36-26-16-12-8-3)44-57-42-32-22-24-34-46(51(5)40-30-31-41-52)35-25-23-33-43-58-45-48(37-27-17-13-9-4)56-50(54)39-29-21-19-15-11-7-2/h46-48,52H,6-45H2,1-5H3 |
| InChIKey | NYRHHFIVCOQQMH-UHFFFAOYSA-N |
| XLogP | 14.91 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 47 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 858.48 |
| LogP ≤ 5 | 14.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|