C27H40O5Si — CID 58905605
methyl (4R,6S)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-hydroxy-6-(hydroxymethyl)octanoate (PubChem CID 58905605) has the molecular formula C27H40O5Si and a molecular weight of 472.70 g/mol. Its IUPAC name is methyl (4R,6S)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-hydroxy-6-(hydroxymethyl)octanoate.
| Compound Name | methyl (4R,6S)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-hydroxy-6-(hydroxymethyl)octanoate |
|---|---|
| PubChem CID | 58905605 |
| Molecular Formula | C27H40O5Si |
| Molecular Weight | 472.70 g/mol |
| Exact Mass | 472.26 |
| IUPAC Name | methyl (4R,6S)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-hydroxy-6-(hydroxymethyl)octanoate |
| SMILES | CC[C@@](O)(CO)C[C@@H](CCC(=O)OC)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C27H40O5Si/c1-6-27(30,21-28)19-22(17-18-25(29)31-5)20-32-33(26(2,3)4,23-13-9-7-10-14-23)24-15-11-8-12-16-24/h7-16,22,28,30H,6,17-21H2,1-5H3/t22-,27+/m1/s1 |
| InChIKey | QHLBAQDLCFFUTH-AMGIVPHBSA-N |
| XLogP | 3.66 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.70 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|