C30H39NO2Si — CID 11225259
(1S)-1-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-2,3,3a,4,5,7,8,9-octahydro-1H-pyrrolo[1,2-a]quinolin-6-one (PubChem CID 11225259) has the molecular formula C30H39NO2Si and a molecular weight of 473.73 g/mol. Its IUPAC name is (1S)-1-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-2,3,3a,4,5,7,8,9-octahydro-1H-pyrrolo[1,2-a]quinolin-6-one.
| Compound Name | (1S)-1-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-2,3,3a,4,5,7,8,9-octahydro-1H-pyrrolo[1,2-a]quinolin-6-one |
|---|---|
| PubChem CID | 11225259 |
| Molecular Formula | C30H39NO2Si |
| Molecular Weight | 473.73 g/mol |
| Exact Mass | 473.28 |
| IUPAC Name | (1S)-1-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-2,3,3a,4,5,7,8,9-octahydro-1H-pyrrolo[1,2-a]quinolin-6-one |
| SMILES | CC(C)(C)[Si](OCC[C@@H]1CCC2CCC3=C(CCCC3=O)N21)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H39NO2Si/c1-30(2,3)34(25-11-6-4-7-12-25,26-13-8-5-9-14-26)33-22-21-24-18-17-23-19-20-27-28(31(23)24)15-10-16-29(27)32/h4-9,11-14,23-24H,10,15-22H2,1-3H3/t23?,24-/m0/s1 |
| InChIKey | JPTXMPXCFHYZNO-CGAIIQECSA-N |
| XLogP | 5.59 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.73 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|