C20H27NO5 — CID 164752505
tert-butyl 3-(3-methoxy-4-methylbenzoyl)-5-methyl-2-oxopiperidine-1-carboxylate (PubChem CID 164752505) has the molecular formula C20H27NO5 and a molecular weight of 361.44 g/mol. Its IUPAC name is tert-butyl 3-(3-methoxy-4-methylbenzoyl)-5-methyl-2-oxopiperidine-1-carboxylate.
| Compound Name | tert-butyl 3-(3-methoxy-4-methylbenzoyl)-5-methyl-2-oxopiperidine-1-carboxylate |
|---|---|
| PubChem CID | 164752505 |
| Molecular Formula | C20H27NO5 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.19 |
| IUPAC Name | tert-butyl 3-(3-methoxy-4-methylbenzoyl)-5-methyl-2-oxopiperidine-1-carboxylate |
| SMILES | COc1cc(C(=O)C2CC(C)CN(C(=O)OC(C)(C)C)C2=O)ccc1C |
| InChI | InChI=1S/C20H27NO5/c1-12-9-15(17(22)14-8-7-13(2)16(10-14)25-6)18(23)21(11-12)19(24)26-20(3,4)5/h7-8,10,12,15H,9,11H2,1-6H3 |
| InChIKey | ZYTDCAMXXMVUSP-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|