C18H23NO5 — CID 139296234
tert-butyl 3-(4-methoxybenzoyl)-4-oxopiperidine-1-carboxylate (PubChem CID 139296234) has the molecular formula C18H23NO5 and a molecular weight of 333.38 g/mol. Its IUPAC name is tert-butyl 3-(4-methoxybenzoyl)-4-oxopiperidine-1-carboxylate.
| Compound Name | tert-butyl 3-(4-methoxybenzoyl)-4-oxopiperidine-1-carboxylate |
|---|---|
| PubChem CID | 139296234 |
| Molecular Formula | C18H23NO5 |
| Molecular Weight | 333.38 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | tert-butyl 3-(4-methoxybenzoyl)-4-oxopiperidine-1-carboxylate |
| SMILES | COc1ccc(C(=O)C2CN(C(=O)OC(C)(C)C)CCC2=O)cc1 |
| InChI | InChI=1S/C18H23NO5/c1-18(2,3)24-17(22)19-10-9-15(20)14(11-19)16(21)12-5-7-13(23-4)8-6-12/h5-8,14H,9-11H2,1-4H3 |
| InChIKey | OWCYIMIFALFDJS-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.38 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|