C18H23NO4S — CID 142507270
tert-butyl (1S)-7-(4-methoxybenzoyl)-6-thia-2-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 142507270) has the molecular formula C18H23NO4S and a molecular weight of 349.45 g/mol. Its IUPAC name is tert-butyl (1S)-7-(4-methoxybenzoyl)-6-thia-2-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | tert-butyl (1S)-7-(4-methoxybenzoyl)-6-thia-2-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 142507270 |
| Molecular Formula | C18H23NO4S |
| Molecular Weight | 349.45 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | tert-butyl (1S)-7-(4-methoxybenzoyl)-6-thia-2-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | COc1ccc(C(=O)C2SC3CCN(C(=O)OC(C)(C)C)[C@@H]32)cc1 |
| InChI | InChI=1S/C18H23NO4S/c1-18(2,3)23-17(21)19-10-9-13-14(19)16(24-13)15(20)11-5-7-12(22-4)8-6-11/h5-8,13-14,16H,9-10H2,1-4H3/t13?,14-,16?/m0/s1 |
| InChIKey | CEZURGFGORIAEF-BBBYJDLNSA-N |
| XLogP | 3.37 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.45 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |