C15H19N3O4 — CID 67382864
tert-butyl 4-oxo-3-(pyrimidine-2-carbonyl)piperidine-1-carboxylate (PubChem CID 67382864) has the molecular formula C15H19N3O4 and a molecular weight of 305.33 g/mol. Its IUPAC name is tert-butyl 4-oxo-3-(pyrimidine-2-carbonyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-oxo-3-(pyrimidine-2-carbonyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 67382864 |
| Molecular Formula | C15H19N3O4 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | tert-butyl 4-oxo-3-(pyrimidine-2-carbonyl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(=O)C(C(=O)c2ncccn2)C1 |
| InChI | InChI=1S/C15H19N3O4/c1-15(2,3)22-14(21)18-8-5-11(19)10(9-18)12(20)13-16-6-4-7-17-13/h4,6-7,10H,5,8-9H2,1-3H3 |
| InChIKey | UYNBVYHYMDWREU-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 89.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|