C14H25NO4 — CID 11975533
tert-butyl (3R)-3-[(1R)-1-hydroxy-2-methylpropyl]-4-oxopiperidine-1-carboxylate (PubChem CID 11975533) has the molecular formula C14H25NO4 and a molecular weight of 271.36 g/mol. Its IUPAC name is tert-butyl (3R)-3-[(1R)-1-hydroxy-2-methylpropyl]-4-oxopiperidine-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-[(1R)-1-hydroxy-2-methylpropyl]-4-oxopiperidine-1-carboxylate |
|---|---|
| PubChem CID | 11975533 |
| Molecular Formula | C14H25NO4 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.18 |
| IUPAC Name | tert-butyl (3R)-3-[(1R)-1-hydroxy-2-methylpropyl]-4-oxopiperidine-1-carboxylate |
| SMILES | CC(C)[C@@H](O)[C@H]1CN(C(=O)OC(C)(C)C)CCC1=O |
| InChI | InChI=1S/C14H25NO4/c1-9(2)12(17)10-8-15(7-6-11(10)16)13(18)19-14(3,4)5/h9-10,12,17H,6-8H2,1-5H3/t10-,12+/m0/s1 |
| InChIKey | PGIYNDQJVHDOQK-CMPLNLGQSA-N |
| XLogP | 1.83 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |