C14H25NO4 — CID 114451390
tert-butyl 3-(3-hydroxy-2-methylpropyl)-4-oxopiperidine-1-carboxylate (PubChem CID 114451390) has the molecular formula C14H25NO4 and a molecular weight of 271.36 g/mol. Its IUPAC name is tert-butyl 3-(3-hydroxy-2-methylpropyl)-4-oxopiperidine-1-carboxylate.
| Compound Name | tert-butyl 3-(3-hydroxy-2-methylpropyl)-4-oxopiperidine-1-carboxylate |
|---|---|
| PubChem CID | 114451390 |
| Molecular Formula | C14H25NO4 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.18 |
| IUPAC Name | tert-butyl 3-(3-hydroxy-2-methylpropyl)-4-oxopiperidine-1-carboxylate |
| SMILES | CC(CO)CC1CN(C(=O)OC(C)(C)C)CCC1=O |
| InChI | InChI=1S/C14H25NO4/c1-10(9-16)7-11-8-15(6-5-12(11)17)13(18)19-14(2,3)4/h10-11,16H,5-9H2,1-4H3 |
| InChIKey | LHTJHNMFEWGGDJ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |