C17H20N2O4 — CID 154944559
(5R)-3-benzoyl-5-ethyl-4-oxo-5-prop-2-enyl-1,3-diazinane-1-carboxylic acid (PubChem CID 154944559) has the molecular formula C17H20N2O4 and a molecular weight of 316.36 g/mol. Its IUPAC name is (5R)-3-benzoyl-5-ethyl-4-oxo-5-prop-2-enyl-1,3-diazinane-1-carboxylic acid.
| Compound Name | (5R)-3-benzoyl-5-ethyl-4-oxo-5-prop-2-enyl-1,3-diazinane-1-carboxylic acid |
|---|---|
| PubChem CID | 154944559 |
| Molecular Formula | C17H20N2O4 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | (5R)-3-benzoyl-5-ethyl-4-oxo-5-prop-2-enyl-1,3-diazinane-1-carboxylic acid |
| SMILES | C=CC[C@]1(CC)CN(C(=O)O)CN(C(=O)c2ccccc2)C1=O |
| InChI | InChI=1S/C17H20N2O4/c1-3-10-17(4-2)11-18(16(22)23)12-19(15(17)21)14(20)13-8-6-5-7-9-13/h3,5-9H,1,4,10-12H2,2H3,(H,22,23)/t17-/m1/s1 |
| InChIKey | PYAHRSPMLFDSSK-QGZVFWFLSA-N |
| XLogP | 2.58 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|