C27H25BrFNO5S — CID 71507004
tert-butyl (2R,3R)-3-bromo-2-(3-fluorophenyl)-1-(4-methylphenyl)sulfonyl-4-oxo-2H-quinoline-3-carboxylate (PubChem CID 71507004) has the molecular formula C27H25BrFNO5S and a molecular weight of 574.47 g/mol. Its IUPAC name is tert-butyl (2R,3R)-3-bromo-2-(3-fluorophenyl)-1-(4-methylphenyl)sulfonyl-4-oxo-2H-quinoline-3-carboxylate.
| Compound Name | tert-butyl (2R,3R)-3-bromo-2-(3-fluorophenyl)-1-(4-methylphenyl)sulfonyl-4-oxo-2H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 71507004 |
| Molecular Formula | C27H25BrFNO5S |
| Molecular Weight | 574.47 g/mol |
| Exact Mass | 573.06 |
| IUPAC Name | tert-butyl (2R,3R)-3-bromo-2-(3-fluorophenyl)-1-(4-methylphenyl)sulfonyl-4-oxo-2H-quinoline-3-carboxylate |
| SMILES | Cc1ccc(S(=O)(=O)N2c3ccccc3C(=O)[C@@](Br)(C(=O)OC(C)(C)C)[C@H]2c2cccc(F)c2)cc1 |
| InChI | InChI=1S/C27H25BrFNO5S/c1-17-12-14-20(15-13-17)36(33,34)30-22-11-6-5-10-21(22)24(31)27(28,25(32)35-26(2,3)4)23(30)18-8-7-9-19(29)16-18/h5-16,23H,1-4H3/t23-,27-/m1/s1 |
| InChIKey | HLXYZINBVUTWME-YIXXDRMTSA-N |
| XLogP | 5.74 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.47 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|