C27H28N2O4S — CID 132851200
tert-butyl 3-(4-methylphenyl)sulfonyl-2-(1-phenylethenyl)-2H-benzimidazole-1-carboxylate (PubChem CID 132851200) has the molecular formula C27H28N2O4S and a molecular weight of 476.60 g/mol. Its IUPAC name is tert-butyl 3-(4-methylphenyl)sulfonyl-2-(1-phenylethenyl)-2H-benzimidazole-1-carboxylate.
| Compound Name | tert-butyl 3-(4-methylphenyl)sulfonyl-2-(1-phenylethenyl)-2H-benzimidazole-1-carboxylate |
|---|---|
| PubChem CID | 132851200 |
| Molecular Formula | C27H28N2O4S |
| Molecular Weight | 476.60 g/mol |
| Exact Mass | 476.18 |
| IUPAC Name | tert-butyl 3-(4-methylphenyl)sulfonyl-2-(1-phenylethenyl)-2H-benzimidazole-1-carboxylate |
| SMILES | C=C(c1ccccc1)C1N(C(=O)OC(C)(C)C)c2ccccc2N1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C27H28N2O4S/c1-19-15-17-22(18-16-19)34(31,32)29-24-14-10-9-13-23(24)28(26(30)33-27(3,4)5)25(29)20(2)21-11-7-6-8-12-21/h6-18,25H,2H2,1,3-5H3 |
| InChIKey | AOVRTOSCUHUKJT-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.60 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |