C21H16Cl2N2O3S — CID 143492304
2-[5-(3,4-dichlorophenyl)sulfonyl-6H-phenanthridin-6-yl]acetamide (PubChem CID 143492304) has the molecular formula C21H16Cl2N2O3S and a molecular weight of 447.34 g/mol. Its IUPAC name is 2-[5-(3,4-dichlorophenyl)sulfonyl-6H-phenanthridin-6-yl]acetamide.
| Compound Name | 2-[5-(3,4-dichlorophenyl)sulfonyl-6H-phenanthridin-6-yl]acetamide |
|---|---|
| PubChem CID | 143492304 |
| Molecular Formula | C21H16Cl2N2O3S |
| Molecular Weight | 447.34 g/mol |
| Exact Mass | 446.03 |
| IUPAC Name | 2-[5-(3,4-dichlorophenyl)sulfonyl-6H-phenanthridin-6-yl]acetamide |
| SMILES | NC(=O)CC1c2ccccc2-c2ccccc2N1S(=O)(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C21H16Cl2N2O3S/c22-17-10-9-13(11-18(17)23)29(27,28)25-19-8-4-3-6-15(19)14-5-1-2-7-16(14)20(25)12-21(24)26/h1-11,20H,12H2,(H2,24,26) |
| InChIKey | PLXQWVVIBFUAFN-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.34 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |