C44H34Cl4N2O10S2 — CID 87401876
2,2-bis[5-(3,4-dichlorophenyl)sulfonyl-8,10-dimethoxy-6H-phenanthridin-6-yl]acetic acid (PubChem CID 87401876) has the molecular formula C44H34Cl4N2O10S2 and a molecular weight of 956.71 g/mol. Its IUPAC name is 2,2-bis[5-(3,4-dichlorophenyl)sulfonyl-8,10-dimethoxy-6H-phenanthridin-6-yl]acetic acid.
| Compound Name | 2,2-bis[5-(3,4-dichlorophenyl)sulfonyl-8,10-dimethoxy-6H-phenanthridin-6-yl]acetic acid |
|---|---|
| PubChem CID | 87401876 |
| Molecular Formula | C44H34Cl4N2O10S2 |
| Molecular Weight | 956.71 g/mol |
| Exact Mass | 954.04 |
| IUPAC Name | 2,2-bis[5-(3,4-dichlorophenyl)sulfonyl-8,10-dimethoxy-6H-phenanthridin-6-yl]acetic acid |
| SMILES | COc1cc(OC)c2c(c1)C(C(C(=O)O)C1c3cc(OC)cc(OC)c3-c3ccccc3N1S(=O)(=O)c1ccc(Cl)c(Cl)c1)N(S(=O)(=O)c1ccc(Cl)c(Cl)c1)c1ccccc1-2 |
| InChI | InChI=1S/C44H34Cl4N2O10S2/c1-57-23-17-29-39(37(19-23)59-3)27-9-5-7-11-35(27)49(61(53,54)25-13-15-31(45)33(47)21-25)42(29)41(44(51)52)43-30-18-24(58-2)20-38(60-4)40(30)28-10-6-8-12-36(28)50(43)62(55,56)26-14-16-32(46)34(48)22-26/h5-22,41-43H,1-4H3,(H,51,52) |
| InChIKey | PFZMXOJCTUJZMY-UHFFFAOYSA-N |
| XLogP | 10.57 |
| TPSA | 148.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 956.71 |
| LogP ≤ 5 | 10.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |