C16H13Cl2NO4S — CID 66755963
methyl 1-(3,4-dichlorophenyl)sulfonyl-2,3-dihydroindole-2-carboxylate (PubChem CID 66755963) has the molecular formula C16H13Cl2NO4S and a molecular weight of 386.26 g/mol. Its IUPAC name is methyl 1-(3,4-dichlorophenyl)sulfonyl-2,3-dihydroindole-2-carboxylate.
| Compound Name | methyl 1-(3,4-dichlorophenyl)sulfonyl-2,3-dihydroindole-2-carboxylate |
|---|---|
| PubChem CID | 66755963 |
| Molecular Formula | C16H13Cl2NO4S |
| Molecular Weight | 386.26 g/mol |
| Exact Mass | 384.99 |
| IUPAC Name | methyl 1-(3,4-dichlorophenyl)sulfonyl-2,3-dihydroindole-2-carboxylate |
| SMILES | COC(=O)C1Cc2ccccc2N1S(=O)(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H13Cl2NO4S/c1-23-16(20)15-8-10-4-2-3-5-14(10)19(15)24(21,22)11-6-7-12(17)13(18)9-11/h2-7,9,15H,8H2,1H3 |
| InChIKey | NKGCLPHUWUADDY-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.26 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |