C17H14N2O4S — CID 94776755
methyl (2R)-1-(3-cyanophenyl)sulfonyl-2,3-dihydroindole-2-carboxylate (PubChem CID 94776755) has the molecular formula C17H14N2O4S and a molecular weight of 342.38 g/mol. Its IUPAC name is methyl (2R)-1-(3-cyanophenyl)sulfonyl-2,3-dihydroindole-2-carboxylate.
| Compound Name | methyl (2R)-1-(3-cyanophenyl)sulfonyl-2,3-dihydroindole-2-carboxylate |
|---|---|
| PubChem CID | 94776755 |
| Molecular Formula | C17H14N2O4S |
| Molecular Weight | 342.38 g/mol |
| Exact Mass | 342.07 |
| IUPAC Name | methyl (2R)-1-(3-cyanophenyl)sulfonyl-2,3-dihydroindole-2-carboxylate |
| SMILES | COC(=O)[C@H]1Cc2ccccc2N1S(=O)(=O)c1cccc(C#N)c1 |
| InChI | InChI=1S/C17H14N2O4S/c1-23-17(20)16-10-13-6-2-3-8-15(13)19(16)24(21,22)14-7-4-5-12(9-14)11-18/h2-9,16H,10H2,1H3/t16-/m1/s1 |
| InChIKey | FPJBUOPAFHEANP-MRXNPFEDSA-N |
| XLogP | 1.85 |
| TPSA | 87.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.38 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |